C18H17F2N3O2S — CID 18575330
2-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole (PubChem CID 18575330) has the molecular formula C18H17F2N3O2S and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 18575330 |
| Molecular Formula | C18H17F2N3O2S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2-[1-(2,5-difluorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C18H17F2N3O2S/c19-13-5-6-14(20)17(11-13)26(24,25)23-9-7-12(8-10-23)18-21-15-3-1-2-4-16(15)22-18/h1-6,11-12H,7-10H2,(H,21,22) |
| InChIKey | PTMOITLIFZUQEP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |