C18H17Cl2N3O2S — CID 18268675
2-[1-(3,5-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole (PubChem CID 18268675) has the molecular formula C18H17Cl2N3O2S and a molecular weight of 410.33 g/mol. Its IUPAC name is 2-[1-(3,5-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole.
| Compound Name | 2-[1-(3,5-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 18268675 |
| Molecular Formula | C18H17Cl2N3O2S |
| Molecular Weight | 410.33 g/mol |
| Exact Mass | 409.04 |
| IUPAC Name | 2-[1-(3,5-dichlorophenyl)sulfonylpiperidin-4-yl]-1H-benzimidazole |
| SMILES | O=S(=O)(c1cc(Cl)cc(Cl)c1)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C18H17Cl2N3O2S/c19-13-9-14(20)11-15(10-13)26(24,25)23-7-5-12(6-8-23)18-21-16-3-1-2-4-17(16)22-18/h1-4,9-12H,5-8H2,(H,21,22) |
| InChIKey | OTPWHSRDMXLIPK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.33 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |