C25H22ClN5O5S — CID 121038062
N-[4-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylphenyl]-2-chloro-5-nitrobenzamide (PubChem CID 121038062) has the molecular formula C25H22ClN5O5S and a molecular weight of 540.00 g/mol. Its IUPAC name is N-[4-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylphenyl]-2-chloro-5-nitrobenzamide.
| Compound Name | N-[4-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylphenyl]-2-chloro-5-nitrobenzamide |
|---|---|
| PubChem CID | 121038062 |
| Molecular Formula | C25H22ClN5O5S |
| Molecular Weight | 540.00 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | N-[4-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylphenyl]-2-chloro-5-nitrobenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCC(c3nc4ccccc4[nH]3)CC2)cc1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C25H22ClN5O5S/c26-21-10-7-18(31(33)34)15-20(21)25(32)27-17-5-8-19(9-6-17)37(35,36)30-13-11-16(12-14-30)24-28-22-3-1-2-4-23(22)29-24/h1-10,15-16H,11-14H2,(H,27,32)(H,28,29) |
| InChIKey | PXPJYUWHDWMGRG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 138.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.00 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|