C22H20N6O2S — CID 168543700
2-[[4-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylanilino]methylidene]propanedinitrile (PubChem CID 168543700) has the molecular formula C22H20N6O2S and a molecular weight of 432.51 g/mol. Its IUPAC name is 2-[[4-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylanilino]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylanilino]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 168543700 |
| Molecular Formula | C22H20N6O2S |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[[4-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]sulfonylanilino]methylidene]propanedinitrile |
| SMILES | N#CC(C#N)=CNc1ccc(S(=O)(=O)N2CCC(c3nc4ccccc4[nH]3)CC2)cc1 |
| InChI | InChI=1S/C22H20N6O2S/c23-13-16(14-24)15-25-18-5-7-19(8-6-18)31(29,30)28-11-9-17(10-12-28)22-26-20-3-1-2-4-21(20)27-22/h1-8,15,17,25H,9-12H2,(H,26,27) |
| InChIKey | HBUCQZHEEHDXPU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 125.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|