C16H13F2N3O2S — CID 90505896
2-[1-(2,5-difluorophenyl)sulfonylazetidin-3-yl]-1H-benzimidazole (PubChem CID 90505896) has the molecular formula C16H13F2N3O2S and a molecular weight of 349.36 g/mol. Its IUPAC name is 2-[1-(2,5-difluorophenyl)sulfonylazetidin-3-yl]-1H-benzimidazole.
| Compound Name | 2-[1-(2,5-difluorophenyl)sulfonylazetidin-3-yl]-1H-benzimidazole |
|---|---|
| PubChem CID | 90505896 |
| Molecular Formula | C16H13F2N3O2S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 2-[1-(2,5-difluorophenyl)sulfonylazetidin-3-yl]-1H-benzimidazole |
| SMILES | O=S(=O)(c1cc(F)ccc1F)N1CC(c2nc3ccccc3[nH]2)C1 |
| InChI | InChI=1S/C16H13F2N3O2S/c17-11-5-6-12(18)15(7-11)24(22,23)21-8-10(9-21)16-19-13-3-1-2-4-14(13)20-16/h1-7,10H,8-9H2,(H,19,20) |
| InChIKey | QEDDNSNGOBLXAW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |