C20H18N4O4S2 — CID 166195706
6-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione (PubChem CID 166195706) has the molecular formula C20H18N4O4S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is 6-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione.
| Compound Name | 6-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 166195706 |
| Molecular Formula | C20H18N4O4S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | 6-[3-(1,3-benzothiazol-2-yl)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(S(=O)(=O)N3CCCC(c4nc5ccccc5s4)C3)ccc2[nH]1 |
| InChI | InChI=1S/C20H18N4O4S2/c25-18-14-10-13(7-8-15(14)22-20(26)23-18)30(27,28)24-9-3-4-12(11-24)19-21-16-5-1-2-6-17(16)29-19/h1-2,5-8,10,12H,3-4,9,11H2,(H2,22,23,25,26) |
| InChIKey | WAZICDGYQXKQBO-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 115.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |