C17H16N4O5S — CID 129325738
6-[(3R)-3-pyridin-3-yloxypyrrolidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione (PubChem CID 129325738) has the molecular formula C17H16N4O5S and a molecular weight of 388.41 g/mol. Its IUPAC name is 6-[(3R)-3-pyridin-3-yloxypyrrolidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione.
| Compound Name | 6-[(3R)-3-pyridin-3-yloxypyrrolidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 129325738 |
| Molecular Formula | C17H16N4O5S |
| Molecular Weight | 388.41 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 6-[(3R)-3-pyridin-3-yloxypyrrolidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(S(=O)(=O)N3CC[C@@H](Oc4cccnc4)C3)ccc2[nH]1 |
| InChI | InChI=1S/C17H16N4O5S/c22-16-14-8-13(3-4-15(14)19-17(23)20-16)27(24,25)21-7-5-12(10-21)26-11-2-1-6-18-9-11/h1-4,6,8-9,12H,5,7,10H2,(H2,19,20,22,23)/t12-/m1/s1 |
| InChIKey | BYGYSCFZIHYJLU-GFCCVEGCSA-N |
| XLogP | 0.45 |
| TPSA | 125.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.41 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |