C17H22N4O4S — CID 119987604
6-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione (PubChem CID 119987604) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 6-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione.
| Compound Name | 6-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 119987604 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 6-[4-(cyclopropylmethylamino)piperidin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)c2cc(S(=O)(=O)N3CCC(NCC4CC4)CC3)ccc2[nH]1 |
| InChI | InChI=1S/C17H22N4O4S/c22-16-14-9-13(3-4-15(14)19-17(23)20-16)26(24,25)21-7-5-12(6-8-21)18-10-11-1-2-11/h3-4,9,11-12,18H,1-2,5-8,10H2,(H2,19,20,22,23) |
| InChIKey | ZFDOWRNKZNLKMX-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 115.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |