C21H24N4O5S — CID 55559273
6-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]sulfonyl-1H-quinazoline-2,4-dione (PubChem CID 55559273) has the molecular formula C21H24N4O5S and a molecular weight of 444.51 g/mol. Its IUPAC name is 6-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]sulfonyl-1H-quinazoline-2,4-dione.
| Compound Name | 6-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 55559273 |
| Molecular Formula | C21H24N4O5S |
| Molecular Weight | 444.51 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | 6-[4-[(4-ethoxyphenyl)methyl]piperazin-1-yl]sulfonyl-1H-quinazoline-2,4-dione |
| SMILES | CCOc1ccc(CN2CCN(S(=O)(=O)c3ccc4[nH]c(=O)[nH]c(=O)c4c3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O5S/c1-2-30-16-5-3-15(4-6-16)14-24-9-11-25(12-10-24)31(28,29)17-7-8-19-18(13-17)20(26)23-21(27)22-19/h3-8,13H,2,9-12,14H2,1H3,(H2,22,23,26,27) |
| InChIKey | GFBILGSMUALMPF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |