C21H26N2O7S — CID 17365974
1-(benzenesulfonyl)-4-[(4-ethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 17365974) has the molecular formula C21H26N2O7S and a molecular weight of 450.51 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-[(4-ethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-(benzenesulfonyl)-4-[(4-ethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 17365974 |
| Molecular Formula | C21H26N2O7S |
| Molecular Weight | 450.51 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 1-(benzenesulfonyl)-4-[(4-ethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | CCOc1ccc(CN2CCN(S(=O)(=O)c3ccccc3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H24N2O3S.C2H2O4/c1-2-24-18-10-8-17(9-11-18)16-20-12-14-21(15-13-20)25(22,23)19-6-4-3-5-7-19;3-1(4)2(5)6/h3-11H,2,12-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | HRZWKHVHDHMXSZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 124.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.51 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|