C19H24ClFN2O3S — CID 17338187
1-(4-ethoxyphenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazine;hydrochloride (PubChem CID 17338187) has the molecular formula C19H24ClFN2O3S and a molecular weight of 414.93 g/mol. Its IUPAC name is 1-(4-ethoxyphenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazine;hydrochloride.
| Compound Name | 1-(4-ethoxyphenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 17338187 |
| Molecular Formula | C19H24ClFN2O3S |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 1-(4-ethoxyphenyl)sulfonyl-4-[(3-fluorophenyl)methyl]piperazine;hydrochloride |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(Cc3cccc(F)c3)CC2)cc1.Cl |
| InChI | InChI=1S/C19H23FN2O3S.ClH/c1-2-25-18-6-8-19(9-7-18)26(23,24)22-12-10-21(11-13-22)15-16-4-3-5-17(20)14-16;/h3-9,14H,2,10-13,15H2,1H3;1H |
| InChIKey | VMIHEYBYQOOOBC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |