C11H16FN3O2S — CID 47147073
4-[(3-fluorophenyl)methyl]piperazine-1-sulfonamide (PubChem CID 47147073) has the molecular formula C11H16FN3O2S and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-[(3-fluorophenyl)methyl]piperazine-1-sulfonamide.
| Compound Name | 4-[(3-fluorophenyl)methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 47147073 |
| Molecular Formula | C11H16FN3O2S |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 4-[(3-fluorophenyl)methyl]piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C11H16FN3O2S/c12-11-3-1-2-10(8-11)9-14-4-6-15(7-5-14)18(13,16)17/h1-3,8H,4-7,9H2,(H2,13,16,17) |
| InChIKey | QQBWEJWAVLTRAQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |