C13H18F3N3O3S — CID 47066558
4-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]piperazine-1-sulfonamide (PubChem CID 47066558) has the molecular formula C13H18F3N3O3S and a molecular weight of 353.37 g/mol. Its IUPAC name is 4-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]piperazine-1-sulfonamide.
| Compound Name | 4-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]piperazine-1-sulfonamide |
|---|---|
| PubChem CID | 47066558 |
| Molecular Formula | C13H18F3N3O3S |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 4-[[3-(2,2,2-trifluoroethoxy)phenyl]methyl]piperazine-1-sulfonamide |
| SMILES | NS(=O)(=O)N1CCN(Cc2cccc(OCC(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C13H18F3N3O3S/c14-13(15,16)10-22-12-3-1-2-11(8-12)9-18-4-6-19(7-5-18)23(17,20)21/h1-3,8H,4-7,9-10H2,(H2,17,20,21) |
| InChIKey | AVAPLLMTBUJPKT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |