C19H20F3N3O2 — CID 154014977
4-[[3-[3-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxamide (PubChem CID 154014977) has the molecular formula C19H20F3N3O2 and a molecular weight of 379.38 g/mol. Its IUPAC name is 4-[[3-[3-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxamide.
| Compound Name | 4-[[3-[3-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 154014977 |
| Molecular Formula | C19H20F3N3O2 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 4-[[3-[3-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxamide |
| SMILES | NC(=O)N1CCN(Cc2cccc(Oc3cccc(C(F)(F)F)c3)c2)CC1 |
| InChI | InChI=1S/C19H20F3N3O2/c20-19(21,22)15-4-2-6-17(12-15)27-16-5-1-3-14(11-16)13-24-7-9-25(10-8-24)18(23)26/h1-6,11-12H,7-10,13H2,(H2,23,26) |
| InChIKey | BAYBAILFQXYKIT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |