C19H19F3N2O3 — CID 67151233
4-[[3-[4-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 67151233) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is 4-[[3-[4-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[3-[4-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67151233 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 4-[[3-[4-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(Cc2cccc(Oc3ccc(C(F)(F)F)cc3)c2)CC1 |
| InChI | InChI=1S/C19H19F3N2O3/c20-19(21,22)15-4-6-16(7-5-15)27-17-3-1-2-14(12-17)13-23-8-10-24(11-9-23)18(25)26/h1-7,12H,8-11,13H2,(H,25,26) |
| InChIKey | YZZNGLNWDSHORP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |