C19H18ClF3N2O3 — CID 142760380
4-[[3-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 142760380) has the molecular formula C19H18ClF3N2O3 and a molecular weight of 414.81 g/mol. Its IUPAC name is 4-[[3-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[3-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 142760380 |
| Molecular Formula | C19H18ClF3N2O3 |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 4-[[3-[4-chloro-3-(trifluoromethyl)phenoxy]phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(Cc2cccc(Oc3ccc(Cl)c(C(F)(F)F)c3)c2)CC1 |
| InChI | InChI=1S/C19H18ClF3N2O3/c20-17-5-4-15(11-16(17)19(21,22)23)28-14-3-1-2-13(10-14)12-24-6-8-25(9-7-24)18(26)27/h1-5,10-11H,6-9,12H2,(H,26,27) |
| InChIKey | RVZGXAMVNZODTH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |