C13H14F4N2O2 — CID 67359778
4-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 67359778) has the molecular formula C13H14F4N2O2 and a molecular weight of 306.26 g/mol. Its IUPAC name is 4-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67359778 |
| Molecular Formula | C13H14F4N2O2 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 4-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(Cc2ccc(F)c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C13H14F4N2O2/c14-11-2-1-9(7-10(11)13(15,16)17)8-18-3-5-19(6-4-18)12(20)21/h1-2,7H,3-6,8H2,(H,20,21) |
| InChIKey | FNSRNOLZCDFHJT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |