C30H46N8O12 — CID 101418290
10-[[4-[(4,7,10-tricarboxy-1,4,7,10-tetrazacyclododec-1-yl)methyl]phenyl]methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid (PubChem CID 101418290) has the molecular formula C30H46N8O12 and a molecular weight of 710.74 g/mol. Its IUPAC name is 10-[[4-[(4,7,10-tricarboxy-1,4,7,10-tetrazacyclododec-1-yl)methyl]phenyl]methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid.
| Compound Name | 10-[[4-[(4,7,10-tricarboxy-1,4,7,10-tetrazacyclododec-1-yl)methyl]phenyl]methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
|---|---|
| PubChem CID | 101418290 |
| Molecular Formula | C30H46N8O12 |
| Molecular Weight | 710.74 g/mol |
| Exact Mass | 710.32 |
| IUPAC Name | 10-[[4-[(4,7,10-tricarboxy-1,4,7,10-tetrazacyclododec-1-yl)methyl]phenyl]methyl]-1,4,7,10-tetrazacyclododecane-1,4,7-tricarboxylic acid |
| SMILES | O=C(O)N1CCN(Cc2ccc(CN3CCN(C(=O)O)CCN(C(=O)O)CCN(C(=O)O)CC3)cc2)CCN(C(=O)O)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C30H46N8O12/c39-25(40)33-9-5-31(6-10-34(26(41)42)14-18-37(17-13-33)29(47)48)21-23-1-2-24(4-3-23)22-32-7-11-35(27(43)44)15-19-38(30(49)50)20-16-36(12-8-32)28(45)46/h1-4H,5-22H2,(H,39,40)(H,41,42)(H,43,44)(H,45,46)(H,47,48)(H,49,50) |
| InChIKey | GXOFLJLYAGBSNZ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 249.72 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.74 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |