C21H29N3O2 — CID 22493469
4-[[4-(4-piperidin-1-ylbut-1-ynyl)phenyl]methyl]piperazine-1-carboxylic acid (PubChem CID 22493469) has the molecular formula C21H29N3O2 and a molecular weight of 355.48 g/mol. Its IUPAC name is 4-[[4-(4-piperidin-1-ylbut-1-ynyl)phenyl]methyl]piperazine-1-carboxylic acid.
| Compound Name | 4-[[4-(4-piperidin-1-ylbut-1-ynyl)phenyl]methyl]piperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 22493469 |
| Molecular Formula | C21H29N3O2 |
| Molecular Weight | 355.48 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 4-[[4-(4-piperidin-1-ylbut-1-ynyl)phenyl]methyl]piperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(Cc2ccc(C#CCCN3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C21H29N3O2/c25-21(26)24-16-14-23(15-17-24)18-20-9-7-19(8-10-20)6-2-5-13-22-11-3-1-4-12-22/h7-10H,1,3-5,11-18H2,(H,25,26) |
| InChIKey | NOJUSMBQCAGOER-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|