C18H28N4O2 — CID 175592709
4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1,4-diazepane-1-carboxylic acid (PubChem CID 175592709) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1,4-diazepane-1-carboxylic acid.
| Compound Name | 4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 175592709 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 4-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]-1,4-diazepane-1-carboxylic acid |
| SMILES | CN1CCN(Cc2ccc(N3CCCN(C(=O)O)CC3)cc2)CC1 |
| InChI | InChI=1S/C18H28N4O2/c1-19-9-11-20(12-10-19)15-16-3-5-17(6-4-16)21-7-2-8-22(14-13-21)18(23)24/h3-6H,2,7-15H2,1H3,(H,23,24) |
| InChIKey | QNCMKPXNKLQEEQ-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|