C15H22N2O — CID 70827633
1-[4-(4-ethylphenyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 70827633) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-[4-(4-ethylphenyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(4-ethylphenyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 70827633 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 1-[4-(4-ethylphenyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CCc1ccc(N2CCCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C15H22N2O/c1-3-14-5-7-15(8-6-14)17-10-4-9-16(11-12-17)13(2)18/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | SXVOZDGMHFOWMY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|