C14H17N3O2 — CID 169353091
1-[4-(4-isocyanatophenyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 169353091) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-[4-(4-isocyanatophenyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-[4-(4-isocyanatophenyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 169353091 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1-[4-(4-isocyanatophenyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(c2ccc(N=C=O)cc2)CC1 |
| InChI | InChI=1S/C14H17N3O2/c1-12(19)16-7-2-8-17(10-9-16)14-5-3-13(4-6-14)15-11-18/h3-6H,2,7-10H2,1H3 |
| InChIKey | MGGNOKMCRDJZOQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|