C13H20N6O4 — CID 67269414
2-[4-(4-acetylpiperazin-1-yl)phenyl]guanidine;nitric acid (PubChem CID 67269414) has the molecular formula C13H20N6O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is 2-[4-(4-acetylpiperazin-1-yl)phenyl]guanidine;nitric acid.
| Compound Name | 2-[4-(4-acetylpiperazin-1-yl)phenyl]guanidine;nitric acid |
|---|---|
| PubChem CID | 67269414 |
| Molecular Formula | C13H20N6O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[4-(4-acetylpiperazin-1-yl)phenyl]guanidine;nitric acid |
| SMILES | CC(=O)N1CCN(c2ccc(N=C(N)N)cc2)CC1.O=[N+]([O-])O |
| InChI | InChI=1S/C13H19N5O.HNO3/c1-10(19)17-6-8-18(9-7-17)12-4-2-11(3-5-12)16-13(14)15;2-1(3)4/h2-5H,6-9H2,1H3,(H4,14,15,16);(H,2,3,4) |
| InChIKey | KKMPVKFXYUTFTK-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 151.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|