C18H23N7O — CID 168601488
1-(diaminomethylidene)-2-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]guanidine (PubChem CID 168601488) has the molecular formula C18H23N7O and a molecular weight of 353.43 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]guanidine |
|---|---|
| PubChem CID | 168601488 |
| Molecular Formula | C18H23N7O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-[4-(4-hydroxyphenyl)piperazin-1-yl]phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(N2CCN(c3ccc(O)cc3)CC2)cc1 |
| InChI | InChI=1S/C18H23N7O/c19-17(20)23-18(21)22-13-1-3-14(4-2-13)24-9-11-25(12-10-24)15-5-7-16(26)8-6-15/h1-8,26H,9-12H2,(H6,19,20,21,22,23) |
| InChIKey | OVGXXFWBMYUPRS-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 129.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|