C18H22FN7 — CID 168606003
1-(diaminomethylidene)-2-[4-[4-(2-fluorophenyl)piperazin-1-yl]phenyl]guanidine (PubChem CID 168606003) has the molecular formula C18H22FN7 and a molecular weight of 355.42 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[4-[4-(2-fluorophenyl)piperazin-1-yl]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[4-[4-(2-fluorophenyl)piperazin-1-yl]phenyl]guanidine |
|---|---|
| PubChem CID | 168606003 |
| Molecular Formula | C18H22FN7 |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | 1-(diaminomethylidene)-2-[4-[4-(2-fluorophenyl)piperazin-1-yl]phenyl]guanidine |
| SMILES | NC(N)=N/C(N)=N/c1ccc(N2CCN(c3ccccc3F)CC2)cc1 |
| InChI | InChI=1S/C18H22FN7/c19-15-3-1-2-4-16(15)26-11-9-25(10-12-26)14-7-5-13(6-8-14)23-18(22)24-17(20)21/h1-8H,9-12H2,(H6,20,21,22,23,24) |
| InChIKey | IXQALEDFPFFWIT-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|