C14H22ClN7 — CID 168604135
2-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168604135) has the molecular formula C14H22ClN7 and a molecular weight of 323.83 g/mol. Its IUPAC name is 2-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168604135 |
| Molecular Formula | C14H22ClN7 |
| Molecular Weight | 323.83 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 2-[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | CCN1CCN(c2ccc(/N=C(\N)N=C(N)N)cc2Cl)CC1 |
| InChI | InChI=1S/C14H22ClN7/c1-2-21-5-7-22(8-6-21)12-4-3-10(9-11(12)15)19-14(18)20-13(16)17/h3-4,9H,2,5-8H2,1H3,(H6,16,17,18,19,20) |
| InChIKey | BSZRMJAQSXXZHK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 109.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.83 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|