C14H21ClN6O — CID 168602298
2-[3-chloro-4-(2,6-dimethylmorpholin-4-yl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168602298) has the molecular formula C14H21ClN6O and a molecular weight of 324.82 g/mol. Its IUPAC name is 2-[3-chloro-4-(2,6-dimethylmorpholin-4-yl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[3-chloro-4-(2,6-dimethylmorpholin-4-yl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168602298 |
| Molecular Formula | C14H21ClN6O |
| Molecular Weight | 324.82 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 2-[3-chloro-4-(2,6-dimethylmorpholin-4-yl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | CC1CN(c2ccc(/N=C(\N)N=C(N)N)cc2Cl)CC(C)O1 |
| InChI | InChI=1S/C14H21ClN6O/c1-8-6-21(7-9(2)22-8)12-4-3-10(5-11(12)15)19-14(18)20-13(16)17/h3-5,8-9H,6-7H2,1-2H3,(H6,16,17,18,19,20) |
| InChIKey | WKVXHOZRYUBGMS-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 115.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.82 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|