C13H16ClN7 — CID 168605218
2-[3-chloro-4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(diaminomethylidene)guanidine (PubChem CID 168605218) has the molecular formula C13H16ClN7 and a molecular weight of 305.77 g/mol. Its IUPAC name is 2-[3-chloro-4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(diaminomethylidene)guanidine.
| Compound Name | 2-[3-chloro-4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(diaminomethylidene)guanidine |
|---|---|
| PubChem CID | 168605218 |
| Molecular Formula | C13H16ClN7 |
| Molecular Weight | 305.77 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 2-[3-chloro-4-(3,5-dimethylpyrazol-1-yl)phenyl]-1-(diaminomethylidene)guanidine |
| SMILES | Cc1cc(C)n(-c2ccc(/N=C(\N)N=C(N)N)cc2Cl)n1 |
| InChI | InChI=1S/C13H16ClN7/c1-7-5-8(2)21(20-7)11-4-3-9(6-10(11)14)18-13(17)19-12(15)16/h3-6H,1-2H3,(H6,15,16,17,18,19) |
| InChIKey | AJBCZNMNSIRENB-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.77 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|