C12H12BrN3S — CID 114892139
5-bromo-2-(3,5-dimethylpyrazol-1-yl)benzenecarbothioamide (PubChem CID 114892139) has the molecular formula C12H12BrN3S and a molecular weight of 310.22 g/mol. Its IUPAC name is 5-bromo-2-(3,5-dimethylpyrazol-1-yl)benzenecarbothioamide.
| Compound Name | 5-bromo-2-(3,5-dimethylpyrazol-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 114892139 |
| Molecular Formula | C12H12BrN3S |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | 5-bromo-2-(3,5-dimethylpyrazol-1-yl)benzenecarbothioamide |
| SMILES | Cc1cc(C)n(-c2ccc(Br)cc2C(N)=S)n1 |
| InChI | InChI=1S/C12H12BrN3S/c1-7-5-8(2)16(15-7)11-4-3-9(13)6-10(11)12(14)17/h3-6H,1-2H3,(H2,14,17) |
| InChIKey | KQMPCOOEVGDROL-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|