C12H13BrN2 — CID 130121149
1-(5-bromo-2-methylphenyl)-3,5-dimethylpyrazole (PubChem CID 130121149) has the molecular formula C12H13BrN2 and a molecular weight of 265.15 g/mol. Its IUPAC name is 1-(5-bromo-2-methylphenyl)-3,5-dimethylpyrazole.
| Compound Name | 1-(5-bromo-2-methylphenyl)-3,5-dimethylpyrazole |
|---|---|
| PubChem CID | 130121149 |
| Molecular Formula | C12H13BrN2 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.03 |
| IUPAC Name | 1-(5-bromo-2-methylphenyl)-3,5-dimethylpyrazole |
| SMILES | Cc1cc(C)n(-c2cc(Br)ccc2C)n1 |
| InChI | InChI=1S/C12H13BrN2/c1-8-4-5-11(13)7-12(8)15-10(3)6-9(2)14-15/h4-7H,1-3H3 |
| InChIKey | HVOUEUKBJVIQDQ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |