C14H19N7 — CID 168604101
1-(diaminomethylidene)-2-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]guanidine (PubChem CID 168604101) has the molecular formula C14H19N7 and a molecular weight of 285.36 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]guanidine.
| Compound Name | 1-(diaminomethylidene)-2-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]guanidine |
|---|---|
| PubChem CID | 168604101 |
| Molecular Formula | C14H19N7 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-[(3,5-dimethylpyrazol-1-yl)methyl]phenyl]guanidine |
| SMILES | Cc1cc(C)n(Cc2cccc(/N=C(\N)N=C(N)N)c2)n1 |
| InChI | InChI=1S/C14H19N7/c1-9-6-10(2)21(20-9)8-11-4-3-5-12(7-11)18-14(17)19-13(15)16/h3-7H,8H2,1-2H3,(H6,15,16,17,18,19) |
| InChIKey | YYSKTCLTLLDMAF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|