C10H20ClN7 — CID 11971725
1-(diaminomethylidene)-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]guanidine;hydrochloride (PubChem CID 11971725) has the molecular formula C10H20ClN7 and a molecular weight of 273.77 g/mol. Its IUPAC name is 1-(diaminomethylidene)-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]guanidine;hydrochloride.
| Compound Name | 1-(diaminomethylidene)-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 11971725 |
| Molecular Formula | C10H20ClN7 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-(diaminomethylidene)-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]guanidine;hydrochloride |
| SMILES | Cc1cc(C)n(CCC/N=C(\N)N=C(N)N)n1.Cl |
| InChI | InChI=1S/C10H19N7.ClH/c1-7-6-8(2)17(16-7)5-3-4-14-10(13)15-9(11)12;/h6H,3-5H2,1-2H3,(H6,11,12,13,14,15);1H |
| InChIKey | VWPCXGTWMBFNOS-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 120.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|