C15H22N6 — CID 114542427
1-amino-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-phenylguanidine (PubChem CID 114542427) has the molecular formula C15H22N6 and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-amino-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-phenylguanidine.
| Compound Name | 1-amino-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-phenylguanidine |
|---|---|
| PubChem CID | 114542427 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-amino-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-phenylguanidine |
| SMILES | Cc1cc(C)n(CCC/N=C(\NN)Nc2ccccc2)n1 |
| InChI | InChI=1S/C15H22N6/c1-12-11-13(2)21(20-12)10-6-9-17-15(19-16)18-14-7-4-3-5-8-14/h3-5,7-8,11H,6,9-10,16H2,1-2H3,(H2,17,18,19) |
| InChIKey | JJDFQOTZTHNHOT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|