C16H23N5 — CID 111026897
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-(3-methylphenyl)guanidine (PubChem CID 111026897) has the molecular formula C16H23N5 and a molecular weight of 285.40 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-(3-methylphenyl)guanidine.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-(3-methylphenyl)guanidine |
|---|---|
| PubChem CID | 111026897 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.40 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-(3-methylphenyl)guanidine |
| SMILES | Cc1cccc(N/C(N)=N/CCCn2nc(C)cc2C)c1 |
| InChI | InChI=1S/C16H23N5/c1-12-6-4-7-15(10-12)19-16(17)18-8-5-9-21-14(3)11-13(2)20-21/h4,6-7,10-11H,5,8-9H2,1-3H3,(H3,17,18,19) |
| InChIKey | BRHVUHZTXJURFD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.40 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|