C16H27IN4O — CID 111059830
1-(3-methylphenyl)-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 111059830) has the molecular formula C16H27IN4O and a molecular weight of 418.32 g/mol. Its IUPAC name is 1-(3-methylphenyl)-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-(3-methylphenyl)-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111059830 |
| Molecular Formula | C16H27IN4O |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 1-(3-methylphenyl)-2-(4-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | Cc1cccc(N/C(N)=N/CCCCN2CCOCC2)c1.I |
| InChI | InChI=1S/C16H26N4O.HI/c1-14-5-4-6-15(13-14)19-16(17)18-7-2-3-8-20-9-11-21-12-10-20;/h4-6,13H,2-3,7-12H2,1H3,(H3,17,18,19);1H |
| InChIKey | AQYWRJHPMQLSBG-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|