C20H31N5O2S — CID 111278473
1-[3-(benzenesulfonyl)propyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine (PubChem CID 111278473) has the molecular formula C20H31N5O2S and a molecular weight of 405.57 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111278473 |
| Molecular Formula | C20H31N5O2S |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H31N5O2S/c1-4-21-20(22-12-8-14-25-18(3)16-17(2)24-25)23-13-9-15-28(26,27)19-10-6-5-7-11-19/h5-7,10-11,16H,4,8-9,12-15H2,1-3H3,(H2,21,22,23) |
| InChIKey | CCXQLNYMRISAOI-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|