C20H33N7 — CID 111278139
2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[4-(pyridin-2-ylamino)butyl]guanidine (PubChem CID 111278139) has the molecular formula C20H33N7 and a molecular weight of 371.53 g/mol. Its IUPAC name is 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[4-(pyridin-2-ylamino)butyl]guanidine.
| Compound Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[4-(pyridin-2-ylamino)butyl]guanidine |
|---|---|
| PubChem CID | 111278139 |
| Molecular Formula | C20H33N7 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 371.28 |
| IUPAC Name | 2-[3-(3,5-dimethylpyrazol-1-yl)propyl]-1-ethyl-3-[4-(pyridin-2-ylamino)butyl]guanidine |
| SMILES | CCN/C(=N\CCCn1nc(C)cc1C)NCCCCNc1ccccn1 |
| InChI | InChI=1S/C20H33N7/c1-4-21-20(25-14-9-15-27-18(3)16-17(2)26-27)24-13-8-7-12-23-19-10-5-6-11-22-19/h5-6,10-11,16H,4,7-9,12-15H2,1-3H3,(H,22,23)(H2,21,24,25) |
| InChIKey | RYVWMWPTASKJPU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 79.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|