C16H30IN5 — CID 110966441
1-tert-butyl-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 110966441) has the molecular formula C16H30IN5 and a molecular weight of 419.36 g/mol. Its IUPAC name is 1-tert-butyl-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110966441 |
| Molecular Formula | C16H30IN5 |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 1-tert-butyl-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCNc1ccccn1)NC(C)(C)C.I |
| InChI | InChI=1S/C16H29N5.HI/c1-5-17-15(21-16(2,3)4)20-13-9-8-12-19-14-10-6-7-11-18-14;/h6-7,10-11H,5,8-9,12-13H2,1-4H3,(H,18,19)(H2,17,20,21);1H |
| InChIKey | JVATVLQIDZLPBL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|