C24H36N6 — CID 110986890
1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine (PubChem CID 110986890) has the molecular formula C24H36N6 and a molecular weight of 408.59 g/mol. Its IUPAC name is 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine.
| Compound Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine |
|---|---|
| PubChem CID | 110986890 |
| Molecular Formula | C24H36N6 |
| Molecular Weight | 408.59 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | 1-(1-benzylpiperidin-4-yl)-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine |
| SMILES | CCN/C(=N\CCCCNc1ccccn1)NC1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C24H36N6/c1-2-25-24(28-17-9-8-16-27-23-12-6-7-15-26-23)29-22-13-18-30(19-14-22)20-21-10-4-3-5-11-21/h3-7,10-12,15,22H,2,8-9,13-14,16-20H2,1H3,(H,26,27)(H2,25,28,29) |
| InChIKey | ABKDIUGDKGLHOD-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 64.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.59 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|