C20H34IN5 — CID 111208311
1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide (PubChem CID 111208311) has the molecular formula C20H34IN5 and a molecular weight of 471.43 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111208311 |
| Molecular Formula | C20H34IN5 |
| Molecular Weight | 471.43 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-ethyl-2-[4-(pyridin-2-ylamino)butyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCCNc1ccccn1)NCCC1=CCCCC1.I |
| InChI | InChI=1S/C20H33N5.HI/c1-2-21-20(25-17-13-18-10-4-3-5-11-18)24-16-9-8-15-23-19-12-6-7-14-22-19;/h6-7,10,12,14H,2-5,8-9,11,13,15-17H2,1H3,(H,22,23)(H2,21,24,25);1H |
| InChIKey | UEGSHISQQWQLAE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|