C17H32IN3O2 — CID 111208209
methyl 5-[[[2-(cyclohexen-1-yl)ethylamino]-(ethylamino)methylidene]amino]pentanoate;hydroiodide (PubChem CID 111208209) has the molecular formula C17H32IN3O2 and a molecular weight of 437.37 g/mol. Its IUPAC name is methyl 5-[[[2-(cyclohexen-1-yl)ethylamino]-(ethylamino)methylidene]amino]pentanoate;hydroiodide.
| Compound Name | methyl 5-[[[2-(cyclohexen-1-yl)ethylamino]-(ethylamino)methylidene]amino]pentanoate;hydroiodide |
|---|---|
| PubChem CID | 111208209 |
| Molecular Formula | C17H32IN3O2 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | methyl 5-[[[2-(cyclohexen-1-yl)ethylamino]-(ethylamino)methylidene]amino]pentanoate;hydroiodide |
| SMILES | CCN/C(=N\CCCCC(=O)OC)NCCC1=CCCCC1.I |
| InChI | InChI=1S/C17H31N3O2.HI/c1-3-18-17(19-13-8-7-11-16(21)22-2)20-14-12-15-9-5-4-6-10-15;/h9H,3-8,10-14H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | JFVNCESVBQXYFG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|