C19H35IN6O — CID 111942058
N,N-diethyl-3-[[N-ethyl-N'-[4-(pyridin-2-ylamino)butyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111942058) has the molecular formula C19H35IN6O and a molecular weight of 490.43 g/mol. Its IUPAC name is N,N-diethyl-3-[[N-ethyl-N'-[4-(pyridin-2-ylamino)butyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N,N-diethyl-3-[[N-ethyl-N'-[4-(pyridin-2-ylamino)butyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111942058 |
| Molecular Formula | C19H35IN6O |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.19 |
| IUPAC Name | N,N-diethyl-3-[[N-ethyl-N'-[4-(pyridin-2-ylamino)butyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCNc1ccccn1)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C19H34N6O.HI/c1-4-20-19(24-16-12-18(26)25(5-2)6-3)23-15-10-9-14-22-17-11-7-8-13-21-17;/h7-8,11,13H,4-6,9-10,12,14-16H2,1-3H3,(H,21,22)(H2,20,23,24);1H |
| InChIKey | LWEIZZDBVHZPRU-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|