C21H38IN5O — CID 111942064
3-[[N'-[3-[benzyl(methyl)amino]propyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111942064) has the molecular formula C21H38IN5O and a molecular weight of 503.47 g/mol. Its IUPAC name is 3-[[N'-[3-[benzyl(methyl)amino]propyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[3-[benzyl(methyl)amino]propyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111942064 |
| Molecular Formula | C21H38IN5O |
| Molecular Weight | 503.47 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | 3-[[N'-[3-[benzyl(methyl)amino]propyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCN(C)Cc1ccccc1)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C21H37N5O.HI/c1-5-22-21(24-16-14-20(27)26(6-2)7-3)23-15-11-17-25(4)18-19-12-9-8-10-13-19;/h8-10,12-13H,5-7,11,14-18H2,1-4H3,(H2,22,23,24);1H |
| InChIKey | CNIAQGVMXXHRHZ-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|