C19H32N4OS — CID 111627434
N-benzyl-3-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]-N-methylpropanamide (PubChem CID 111627434) has the molecular formula C19H32N4OS and a molecular weight of 364.56 g/mol. Its IUPAC name is N-benzyl-3-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]-N-methylpropanamide.
| Compound Name | N-benzyl-3-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 111627434 |
| Molecular Formula | C19H32N4OS |
| Molecular Weight | 364.56 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | N-benzyl-3-[[N-ethyl-N'-(4-methylsulfanylbutyl)carbamimidoyl]amino]-N-methylpropanamide |
| SMILES | CCN/C(=N\CCCCSC)NCCC(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C19H32N4OS/c1-4-20-19(21-13-8-9-15-25-3)22-14-12-18(24)23(2)16-17-10-6-5-7-11-17/h5-7,10-11H,4,8-9,12-16H2,1-3H3,(H2,20,21,22) |
| InChIKey | WCPKSGCTFYXQJC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.56 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|