C25H45IN6O — CID 111942216
3-[[N'-[4-(4-benzylpiperazin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide (PubChem CID 111942216) has the molecular formula C25H45IN6O and a molecular weight of 572.58 g/mol. Its IUPAC name is 3-[[N'-[4-(4-benzylpiperazin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[4-(4-benzylpiperazin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111942216 |
| Molecular Formula | C25H45IN6O |
| Molecular Weight | 572.58 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | 3-[[N'-[4-(4-benzylpiperazin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCN(Cc2ccccc2)CC1)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C25H44N6O.HI/c1-4-26-25(28-16-14-24(32)31(5-2)6-3)27-15-10-11-17-29-18-20-30(21-19-29)22-23-12-8-7-9-13-23;/h7-9,12-13H,4-6,10-11,14-22H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | CDTQPMINRVYNFE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.58 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|