C18H32BrN5 — CID 51127623
2-[2-(4-benzylpiperazin-1-yl)ethyl]-1,3-diethylguanidine;hydrobromide (PubChem CID 51127623) has the molecular formula C18H32BrN5 and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-[2-(4-benzylpiperazin-1-yl)ethyl]-1,3-diethylguanidine;hydrobromide.
| Compound Name | 2-[2-(4-benzylpiperazin-1-yl)ethyl]-1,3-diethylguanidine;hydrobromide |
|---|---|
| PubChem CID | 51127623 |
| Molecular Formula | C18H32BrN5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 2-[2-(4-benzylpiperazin-1-yl)ethyl]-1,3-diethylguanidine;hydrobromide |
| SMILES | Br.CCNC(=NCCN1CCN(Cc2ccccc2)CC1)NCC |
| InChI | InChI=1S/C18H31N5.BrH/c1-3-19-18(20-4-2)21-10-11-22-12-14-23(15-13-22)16-17-8-6-5-7-9-17;/h5-9H,3-4,10-16H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | DQVLSIKNLDENNW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|