C24H41IN6O — CID 111928231
N-[2-[[N'-[4-(4-benzylpiperazin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 111928231) has the molecular formula C24H41IN6O and a molecular weight of 556.54 g/mol. Its IUPAC name is N-[2-[[N'-[4-(4-benzylpiperazin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-[4-(4-benzylpiperazin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111928231 |
| Molecular Formula | C24H41IN6O |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.24 |
| IUPAC Name | N-[2-[[N'-[4-(4-benzylpiperazin-1-yl)butyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCCN1CCN(Cc2ccccc2)CC1)NCCNC(=O)C1CC1.I |
| InChI | InChI=1S/C24H40N6O.HI/c1-2-25-24(28-14-13-26-23(31)22-10-11-22)27-12-6-7-15-29-16-18-30(19-17-29)20-21-8-4-3-5-9-21;/h3-5,8-9,22H,2,6-7,10-20H2,1H3,(H,26,31)(H2,25,27,28);1H |
| InChIKey | GNDSHAYQWWKRMJ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|