C20H34N4O3S — CID 111942021
3-[[N'-(3-benzylsulfonylpropyl)-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide (PubChem CID 111942021) has the molecular formula C20H34N4O3S and a molecular weight of 410.58 g/mol. Its IUPAC name is 3-[[N'-(3-benzylsulfonylpropyl)-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide.
| Compound Name | 3-[[N'-(3-benzylsulfonylpropyl)-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 111942021 |
| Molecular Formula | C20H34N4O3S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.24 |
| IUPAC Name | 3-[[N'-(3-benzylsulfonylpropyl)-N-ethylcarbamimidoyl]amino]-N,N-diethylpropanamide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)Cc1ccccc1)NCCC(=O)N(CC)CC |
| InChI | InChI=1S/C20H34N4O3S/c1-4-21-20(23-15-13-19(25)24(5-2)6-3)22-14-10-16-28(26,27)17-18-11-8-7-9-12-18/h7-9,11-12H,4-6,10,13-17H2,1-3H3,(H2,21,22,23) |
| InChIKey | VMSDYRFIVDIFJC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|