C21H28ClN3O2S — CID 111882247
2-(3-benzylsulfonylpropyl)-1-[2-(2-chlorophenyl)ethyl]-3-ethylguanidine (PubChem CID 111882247) has the molecular formula C21H28ClN3O2S and a molecular weight of 421.99 g/mol. Its IUPAC name is 2-(3-benzylsulfonylpropyl)-1-[2-(2-chlorophenyl)ethyl]-3-ethylguanidine.
| Compound Name | 2-(3-benzylsulfonylpropyl)-1-[2-(2-chlorophenyl)ethyl]-3-ethylguanidine |
|---|---|
| PubChem CID | 111882247 |
| Molecular Formula | C21H28ClN3O2S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-(3-benzylsulfonylpropyl)-1-[2-(2-chlorophenyl)ethyl]-3-ethylguanidine |
| SMILES | CCN/C(=N\CCCS(=O)(=O)Cc1ccccc1)NCCc1ccccc1Cl |
| InChI | InChI=1S/C21H28ClN3O2S/c1-2-23-21(25-15-13-19-11-6-7-12-20(19)22)24-14-8-16-28(26,27)17-18-9-4-3-5-10-18/h3-7,9-12H,2,8,13-17H2,1H3,(H2,23,24,25) |
| InChIKey | PZBHLVYLAKTUSA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|