C24H33IN4O2S — CID 111974393
2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide (PubChem CID 111974393) has the molecular formula C24H33IN4O2S and a molecular weight of 568.53 g/mol. Its IUPAC name is 2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111974393 |
| Molecular Formula | C24H33IN4O2S |
| Molecular Weight | 568.53 g/mol |
| Exact Mass | 568.14 |
| IUPAC Name | 2-(3-benzylsulfonylpropyl)-1-ethyl-3-[2-(6-methyl-1H-indol-3-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCS(=O)(=O)Cc1ccccc1)NCCc1c[nH]c2cc(C)ccc12.I |
| InChI | InChI=1S/C24H32N4O2S.HI/c1-3-25-24(26-13-7-15-31(29,30)18-20-8-5-4-6-9-20)27-14-12-21-17-28-23-16-19(2)10-11-22(21)23;/h4-6,8-11,16-17,28H,3,7,12-15,18H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | BXWNVDUXXLJNOV-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|